Physics, 16.12.2020 02:40 imthebestatcod

If an object is not accelerating you can be sure that A. it's speed is 0m/s.
B. it has a mass of 0 kg
C. the net force acting on it is 0 N

Answers: 2

Show answers

Answers

Answer from: Quest

answer: the correct answer id option(d).

explanation:

snell's law refraction:

$\frac{n_2}{n_1}=\frac{sin \theta_1}{sin\theta_2}$

the angle of refraction = $\theta_2=38 ^o$

the angle of incidence = $\theta_1=?$

refractive index of air = $n_1$ = 1

refractive index of glycerol $n_2$ = 1.47

$\frac{1.47}{1}=\frac{sin\theta_1}{sin 38^o}, (sin38^o=0.61)$

$sin\theta_2=0.8967$

$\theta_2=24.2^o, (sin^{-1}0.8967=63.72^o)$

from the given options, the most closest answer to 63.72° is 65° of option (d).

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

vapour or gas assuming atmospheriv pressure

Answer from: Quest

i just did an experiment like this in my science class. also the answer is yes, it will get separated because they are two opposites meaning if they are opposite they can not attract.

hope this .!

Another question on Physics

Physics, 22.06.2019 22:10

7. see worksheet 1 for values of variables x1, x2 and x3 and answer the following questions: a. for each variable find the mean, median, coefficient of skewness, range and population standard deviation. b. compared to variable x1, how are the mean and median affected by extreme values (outliers) seen in x2 and x3. c. is the median or mean the better measure of location for x2 and x3? explain. d. explain the differences in the magnitudes of the skewness coefficients for the three variables. e. what is the relationship between the range and standard deviation looking across the three variables?

Answers: 1

Answer

Physics, 23.06.2019 01:00

What happens to the vapor pressure of a substance when its surface area is increased at constant temperature?

Answers: 3

Answer

Physics, 23.06.2019 02:00

Frequency of electromagnetic waves that a radio station is assigned. what do you call this type of wave?

Answers: 2

Answer

Physics, 23.06.2019 07:30

Why would an orange roll of your cafeteria tray if you stopped suddenly